C28H33NO4Si — CID 101488792
(5R)-1-[(2R)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]-5-[(2R)-5-oxo-2H-furan-2-yl]pyrrolidin-2-one (PubChem CID 101488792) has the molecular formula C28H33NO4Si and a molecular weight of 475.66 g/mol. Its IUPAC name is (5R)-1-[(2R)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]-5-[(2R)-5-oxo-2H-furan-2-yl]pyrrolidin-2-one.
| Compound Name | (5R)-1-[(2R)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]-5-[(2R)-5-oxo-2H-furan-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 101488792 |
| Molecular Formula | C28H33NO4Si |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | (5R)-1-[(2R)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]-5-[(2R)-5-oxo-2H-furan-2-yl]pyrrolidin-2-one |
| SMILES | C=C[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N1C(=O)CC[C@@H]1[C@H]1C=CC(=O)O1 |
| InChI | InChI=1S/C28H33NO4Si/c1-5-21(29-24(16-18-26(29)30)25-17-19-27(31)33-25)20-32-34(28(2,3)4,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h5-15,17,19,21,24-25H,1,16,18,20H2,2-4H3/t21-,24-,25-/m1/s1 |
| InChIKey | YKNDUQDYDPJYFS-NQHRYMMQSA-N |
| XLogP | 3.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|