C29H33NO4Si — CID 101488798
(1R,2S,9R)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxa-10-azatricyclo[8.4.0.02,6]tetradeca-5,7-diene-4,11-dione (PubChem CID 101488798) has the molecular formula C29H33NO4Si and a molecular weight of 487.67 g/mol. Its IUPAC name is (1R,2S,9R)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxa-10-azatricyclo[8.4.0.02,6]tetradeca-5,7-diene-4,11-dione.
| Compound Name | (1R,2S,9R)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxa-10-azatricyclo[8.4.0.02,6]tetradeca-5,7-diene-4,11-dione |
|---|---|
| PubChem CID | 101488798 |
| Molecular Formula | C29H33NO4Si |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | (1R,2S,9R)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxa-10-azatricyclo[8.4.0.02,6]tetradeca-5,7-diene-4,11-dione |
| SMILES | CC(C)(C)[Si](OC[C@H]1C=CC2=CC(=O)O[C@@H]2[C@H]2CCCC(=O)N12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H33NO4Si/c1-29(2,3)35(23-11-6-4-7-12-23,24-13-8-5-9-14-24)33-20-22-18-17-21-19-27(32)34-28(21)25-15-10-16-26(31)30(22)25/h4-9,11-14,17-19,22,25,28H,10,15-16,20H2,1-3H3/t22-,25-,28+/m1/s1 |
| InChIKey | HKWCPDKHGNDBKR-OKEQGEBHSA-N |
| XLogP | 3.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|