C9H10O3 — CID 101489576
(1S,5S,7R)-7-[(E)-prop-1-enyl]-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one (PubChem CID 101489576) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is (1S,5S,7R)-7-[(E)-prop-1-enyl]-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one.
| Compound Name | (1S,5S,7R)-7-[(E)-prop-1-enyl]-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one |
|---|---|
| PubChem CID | 101489576 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | (1S,5S,7R)-7-[(E)-prop-1-enyl]-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one |
| SMILES | C/C=C/[C@H]1O[C@@H]2C=CC(=O)[C@H]1O2 |
| InChI | InChI=1S/C9H10O3/c1-2-3-7-9-6(10)4-5-8(11-7)12-9/h2-5,7-9H,1H3/b3-2+/t7-,8+,9-/m1/s1 |
| InChIKey | WIOVRXXBOAUVNY-XRPQERQRSA-N |
| XLogP | 0.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|