C6H6O3 — CID 5460915
(1R,5R)-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one (PubChem CID 5460915) has the molecular formula C6H6O3 and a molecular weight of 126.11 g/mol. Its IUPAC name is (1R,5R)-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one.
| Compound Name | (1R,5R)-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one |
|---|---|
| PubChem CID | 5460915 |
| Molecular Formula | C6H6O3 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | (1R,5R)-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one |
| SMILES | O=C1C=C[C@@H]2OC[C@H]1O2 |
| InChI | InChI=1S/C6H6O3/c7-4-1-2-6-8-3-5(4)9-6/h1-2,5-6H,3H2/t5-,6-/m1/s1 |
| InChIKey | LCOGJKFAVXDKBI-PHDIDXHHSA-N |
| XLogP | -0.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |