C6H6O3 — CID 699486
(1S,5R)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one (PubChem CID 699486) has the molecular formula C6H6O3 and a molecular weight of 126.11 g/mol. Its IUPAC name is (1S,5R)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one.
| Compound Name | (1S,5R)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one |
|---|---|
| PubChem CID | 699486 |
| Molecular Formula | C6H6O3 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | (1S,5R)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one |
| SMILES | O=C1C=C[C@H]2CO[C@@H]1O2 |
| InChI | InChI=1S/C6H6O3/c7-5-2-1-4-3-8-6(5)9-4/h1-2,4,6H,3H2/t4-,6+/m0/s1 |
| InChIKey | HITOXZPZGPXYHY-UJURSFKZSA-N |
| XLogP | -0.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |