C12H26N3+ — CID 101490813
1-piperidin-1-ium-1-ylidene-N,N'-di(propan-2-yl)methanediamine (PubChem CID 101490813) has the molecular formula C12H26N3+ and a molecular weight of 212.36 g/mol. Its IUPAC name is 1-piperidin-1-ium-1-ylidene-N,N'-di(propan-2-yl)methanediamine.
| Compound Name | 1-piperidin-1-ium-1-ylidene-N,N'-di(propan-2-yl)methanediamine |
|---|---|
| PubChem CID | 101490813 |
| Molecular Formula | C12H26N3+ |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | 1-piperidin-1-ium-1-ylidene-N,N'-di(propan-2-yl)methanediamine |
| SMILES | CC(C)NC(NC(C)C)=[N+]1CCCCC1 |
| InChI | InChI=1S/C12H25N3/c1-10(2)13-12(14-11(3)4)15-8-6-5-7-9-15/h10-11H,5-9H2,1-4H3,(H,13,14)/p+1 |
| InChIKey | RKLAHHDZWUQLLZ-UHFFFAOYSA-O |
| XLogP | 1.53 |
| TPSA | 27.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|