C16H28N2O3 — CID 101491101
tert-butyl (4R)-2,2-dimethyl-4-[(1S)-1-(prop-2-enylamino)prop-2-enyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 101491101) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is tert-butyl (4R)-2,2-dimethyl-4-[(1S)-1-(prop-2-enylamino)prop-2-enyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-2,2-dimethyl-4-[(1S)-1-(prop-2-enylamino)prop-2-enyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 101491101 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | tert-butyl (4R)-2,2-dimethyl-4-[(1S)-1-(prop-2-enylamino)prop-2-enyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CCN[C@@H](C=C)[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28N2O3/c1-8-10-17-12(9-2)13-11-20-16(6,7)18(13)14(19)21-15(3,4)5/h8-9,12-13,17H,1-2,10-11H2,3-7H3/t12-,13-/m0/s1 |
| InChIKey | QUGPLTMUFPAQSU-STQMWFEESA-N |
| XLogP | 2.69 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|