C16H27NOS3 — CID 101491479
N,N-bis(2-methylsulfanylethyl)-2-(3-methylsulfanylpropoxy)aniline (PubChem CID 101491479) has the molecular formula C16H27NOS3 and a molecular weight of 345.60 g/mol. Its IUPAC name is N,N-bis(2-methylsulfanylethyl)-2-(3-methylsulfanylpropoxy)aniline.
| Compound Name | N,N-bis(2-methylsulfanylethyl)-2-(3-methylsulfanylpropoxy)aniline |
|---|---|
| PubChem CID | 101491479 |
| Molecular Formula | C16H27NOS3 |
| Molecular Weight | 345.60 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N,N-bis(2-methylsulfanylethyl)-2-(3-methylsulfanylpropoxy)aniline |
| SMILES | CSCCCOc1ccccc1N(CCSC)CCSC |
| InChI | InChI=1S/C16H27NOS3/c1-19-12-6-11-18-16-8-5-4-7-15(16)17(9-13-20-2)10-14-21-3/h4-5,7-8H,6,9-14H2,1-3H3 |
| InChIKey | IJVVXHDNNPZDPO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.60 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|