About 2-(3-ethylhexoxy)-N,N-dipropylaniline
2-(3-ethylhexoxy)-N,N-dipropylaniline (PubChem CID 165390175) has the molecular formula C20H35NO
and a molecular weight of 305.51 g/mol. Its IUPAC name is 2-(3-ethylhexoxy)-N,N-dipropylaniline.
Molecular Properties
| Compound Name | 2-(3-ethylhexoxy)-N,N-dipropylaniline |
| PubChem CID | 165390175 |
| Molecular Formula | C20H35NO |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.27 |
| IUPAC Name | 2-(3-ethylhexoxy)-N,N-dipropylaniline |
| SMILES | CCCC(CC)CCOc1ccccc1N(CCC)CCC |
| InChI | InChI=1S/C20H35NO/c1-5-11-18(8-4)14-17-22-20-13-10-9-12-19(20)21(15-6-2)16-7-3/h9-10,12-13,18H,5-8,11,14-17H2,1-4H3 |
| InChIKey | CEGVQYQTPNUXOC-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-ethylhexoxy)-N,N-dipropylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethylhexoxy)-N,N-dipropylaniline?
The IUPAC name of 2-(3-ethylhexoxy)-N,N-dipropylaniline (CID 165390175) is 2-(3-ethylhexoxy)-N,N-dipropylaniline.
What is the SMILES notation for 2-(3-ethylhexoxy)-N,N-dipropylaniline?
The canonical SMILES for 2-(3-ethylhexoxy)-N,N-dipropylaniline is CCCC(CC)CCOc1ccccc1N(CCC)CCC.
What is the InChIKey of 2-(3-ethylhexoxy)-N,N-dipropylaniline?
The InChIKey is CEGVQYQTPNUXOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35NO/c1-5-11-18(8-4)14-17-22-20-13-10-9-12-19(20)21(15-6-2)16-7-3/h9-10,12-13,18H,5-8,11,14-17H2,1-4H3.
What are the key properties of 2-(3-ethylhexoxy)-N,N-dipropylaniline?
2-(3-ethylhexoxy)-N,N-dipropylaniline has a molecular weight of 305.51 g/mol, XLogP of 5.91, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethylhexoxy)-N,N-dipropylaniline is sourced from PubChem (CID 165390175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).