C31H30N2O6 — CID 101493388
diethyl (3R,4'S,5'S)-1-acetyl-2-oxo-4',5'-diphenylspiro[indole-3,3'-pyrrolidine]-2',2'-dicarboxylate (PubChem CID 101493388) has the molecular formula C31H30N2O6 and a molecular weight of 526.59 g/mol. Its IUPAC name is diethyl (3R,4'S,5'S)-1-acetyl-2-oxo-4',5'-diphenylspiro[indole-3,3'-pyrrolidine]-2',2'-dicarboxylate.
| Compound Name | diethyl (3R,4'S,5'S)-1-acetyl-2-oxo-4',5'-diphenylspiro[indole-3,3'-pyrrolidine]-2',2'-dicarboxylate |
|---|---|
| PubChem CID | 101493388 |
| Molecular Formula | C31H30N2O6 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | diethyl (3R,4'S,5'S)-1-acetyl-2-oxo-4',5'-diphenylspiro[indole-3,3'-pyrrolidine]-2',2'-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)N[C@H](c2ccccc2)[C@@H](c2ccccc2)[C@]12C(=O)N(C(C)=O)c1ccccc12 |
| InChI | InChI=1S/C31H30N2O6/c1-4-38-28(36)31(29(37)39-5-2)30(23-18-12-13-19-24(23)33(20(3)34)27(30)35)25(21-14-8-6-9-15-21)26(32-31)22-16-10-7-11-17-22/h6-19,25-26,32H,4-5H2,1-3H3/t25-,26-,30-/m1/s1 |
| InChIKey | HSEQUSWARMSPBI-VOKYQHOCSA-N |
| XLogP | 3.81 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|