C11H20O4 — CID 101494560
tert-butyl (2R)-2-hydroxy-2-[(1R)-1-hydroxyethyl]pent-4-enoate (PubChem CID 101494560) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is tert-butyl (2R)-2-hydroxy-2-[(1R)-1-hydroxyethyl]pent-4-enoate.
| Compound Name | tert-butyl (2R)-2-hydroxy-2-[(1R)-1-hydroxyethyl]pent-4-enoate |
|---|---|
| PubChem CID | 101494560 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | tert-butyl (2R)-2-hydroxy-2-[(1R)-1-hydroxyethyl]pent-4-enoate |
| SMILES | C=CC[C@](O)(C(=O)OC(C)(C)C)[C@@H](C)O |
| InChI | InChI=1S/C11H20O4/c1-6-7-11(14,8(2)12)9(13)15-10(3,4)5/h6,8,12,14H,1,7H2,2-5H3/t8-,11-/m1/s1 |
| InChIKey | MIKHFBSOLZINQV-LDYMZIIASA-N |
| XLogP | 1.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|