C11H20O4 — CID 10921914
methyl (2S,3R,4S)-2,3-dihydroxy-4-methyl-2-prop-2-enylhexanoate (PubChem CID 10921914) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is methyl (2S,3R,4S)-2,3-dihydroxy-4-methyl-2-prop-2-enylhexanoate.
| Compound Name | methyl (2S,3R,4S)-2,3-dihydroxy-4-methyl-2-prop-2-enylhexanoate |
|---|---|
| PubChem CID | 10921914 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | methyl (2S,3R,4S)-2,3-dihydroxy-4-methyl-2-prop-2-enylhexanoate |
| SMILES | C=CC[C@@](O)(C(=O)OC)[C@H](O)[C@@H](C)CC |
| InChI | InChI=1S/C11H20O4/c1-5-7-11(14,10(13)15-4)9(12)8(3)6-2/h5,8-9,12,14H,1,6-7H2,2-4H3/t8-,9+,11-/m0/s1 |
| InChIKey | XYECQJJZDLZIIY-NGZCFLSTSA-N |
| XLogP | 0.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|