C22H32O11 — CID 101495235
methyl (2S,3R,4S)-3-ethenyl-4-[2-[(E)-2-methylbut-2-enoyl]oxyethyl]-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylate (PubChem CID 101495235) has the molecular formula C22H32O11 and a molecular weight of 472.49 g/mol. Its IUPAC name is methyl (2S,3R,4S)-3-ethenyl-4-[2-[(E)-2-methylbut-2-enoyl]oxyethyl]-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylate.
| Compound Name | methyl (2S,3R,4S)-3-ethenyl-4-[2-[(E)-2-methylbut-2-enoyl]oxyethyl]-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylate |
|---|---|
| PubChem CID | 101495235 |
| Molecular Formula | C22H32O11 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | methyl (2S,3R,4S)-3-ethenyl-4-[2-[(E)-2-methylbut-2-enoyl]oxyethyl]-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylate |
| SMILES | C=C[C@H]1[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)OC=C(C(=O)OC)[C@H]1CCOC(=O)/C(C)=C/C |
| InChI | InChI=1S/C22H32O11/c1-5-11(3)19(27)30-8-7-13-12(6-2)21(31-10-14(13)20(28)29-4)33-22-18(26)17(25)16(24)15(9-23)32-22/h5-6,10,12-13,15-18,21-26H,2,7-9H2,1,3-4H3/b11-5+/t12-,13+,15-,16-,17+,18-,21+,22+/m1/s1 |
| InChIKey | KZUCANFYZTXXTF-XWJLQNSTSA-N |
| XLogP | -0.47 |
| TPSA | 161.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|