C18H28O11 — CID 163039272
methyl 4-(dimethoxymethyl)-3-ethenyl-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylate (PubChem CID 163039272) has the molecular formula C18H28O11 and a molecular weight of 420.41 g/mol. Its IUPAC name is methyl 4-(dimethoxymethyl)-3-ethenyl-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylate.
| Compound Name | methyl 4-(dimethoxymethyl)-3-ethenyl-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylate |
|---|---|
| PubChem CID | 163039272 |
| Molecular Formula | C18H28O11 |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | methyl 4-(dimethoxymethyl)-3-ethenyl-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylate |
| SMILES | C=CC1C(OC2OC(CO)C(O)C(O)C2O)OC=C(C(=O)OC)C1C(OC)OC |
| InChI | InChI=1S/C18H28O11/c1-5-8-11(17(25-3)26-4)9(15(23)24-2)7-27-16(8)29-18-14(22)13(21)12(20)10(6-19)28-18/h5,7-8,10-14,16-22H,1,6H2,2-4H3 |
| InChIKey | CWQIQFQIBVGOHB-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 153.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|