C18H32N4O2 — CID 101495930
2-(3-butylimidazol-1-ium-1-yl)-N-(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)acetamide (PubChem CID 101495930) has the molecular formula C18H32N4O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-(3-butylimidazol-1-ium-1-yl)-N-(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)acetamide.
| Compound Name | 2-(3-butylimidazol-1-ium-1-yl)-N-(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 101495930 |
| Molecular Formula | C18H32N4O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 2-(3-butylimidazol-1-ium-1-yl)-N-(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)acetamide |
| SMILES | CCCCn1cc[n+](CC(=O)NC2CC(C)(C)N([O-])C(C)(C)C2)c1 |
| InChI | InChI=1S/C18H32N4O2/c1-6-7-8-20-9-10-21(14-20)13-16(23)19-15-11-17(2,3)22(24)18(4,5)12-15/h9-10,14-15H,6-8,11-13H2,1-5H3,(H,19,23) |
| InChIKey | PACALEVTZJRAMF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|