C17H11FN2O3 — CID 10149651
2-[5-[(3-fluorophenyl)methoxy]-1,3-dioxoisoindol-2-yl]acetonitrile (PubChem CID 10149651) has the molecular formula C17H11FN2O3 and a molecular weight of 310.28 g/mol. Its IUPAC name is 2-[5-[(3-fluorophenyl)methoxy]-1,3-dioxoisoindol-2-yl]acetonitrile.
| Compound Name | 2-[5-[(3-fluorophenyl)methoxy]-1,3-dioxoisoindol-2-yl]acetonitrile |
|---|---|
| PubChem CID | 10149651 |
| Molecular Formula | C17H11FN2O3 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-[5-[(3-fluorophenyl)methoxy]-1,3-dioxoisoindol-2-yl]acetonitrile |
| SMILES | N#CCN1C(=O)c2ccc(OCc3cccc(F)c3)cc2C1=O |
| InChI | InChI=1S/C17H11FN2O3/c18-12-3-1-2-11(8-12)10-23-13-4-5-14-15(9-13)17(22)20(7-6-19)16(14)21/h1-5,8-9H,7,10H2 |
| InChIKey | IBTFAWHHINEXOO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|