C17H15FN2O2 — CID 87992944
2-[5-[(3-fluorophenyl)methoxy]-7-oxo-6,7a-dihydro-1H-isoindol-2-yl]acetonitrile (PubChem CID 87992944) has the molecular formula C17H15FN2O2 and a molecular weight of 298.32 g/mol. Its IUPAC name is 2-[5-[(3-fluorophenyl)methoxy]-7-oxo-6,7a-dihydro-1H-isoindol-2-yl]acetonitrile.
| Compound Name | 2-[5-[(3-fluorophenyl)methoxy]-7-oxo-6,7a-dihydro-1H-isoindol-2-yl]acetonitrile |
|---|---|
| PubChem CID | 87992944 |
| Molecular Formula | C17H15FN2O2 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-[5-[(3-fluorophenyl)methoxy]-7-oxo-6,7a-dihydro-1H-isoindol-2-yl]acetonitrile |
| SMILES | N#CCN1C=C2C=C(OCc3cccc(F)c3)CC(=O)C2C1 |
| InChI | InChI=1S/C17H15FN2O2/c18-14-3-1-2-12(6-14)11-22-15-7-13-9-20(5-4-19)10-16(13)17(21)8-15/h1-3,6-7,9,16H,5,8,10-11H2 |
| InChIKey | OHWHBBWJAHHDQK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|