C36H33F2N5O5 — CID 160501661
(3R)-1-[4-[(3-fluorophenyl)methoxy]phenyl]-N'-hydroxy-5-oxopyrrolidine-3-carboximidamide;(3R)-1-[4-[(3-fluorophenyl)methoxy]phenyl]-5-oxopyrrolidine-3-carbonitrile (PubChem CID 160501661) has the molecular formula C36H33F2N5O5 and a molecular weight of 653.69 g/mol. Its IUPAC name is (3R)-1-[4-[(3-fluorophenyl)methoxy]phenyl]-N'-hydroxy-5-oxopyrrolidine-3-carboximidamide;(3R)-1-[4-[(3-fluorophenyl)methoxy]phenyl]-5-oxopyrrolidine-3-carbonitrile.
| Compound Name | (3R)-1-[4-[(3-fluorophenyl)methoxy]phenyl]-N'-hydroxy-5-oxopyrrolidine-3-carboximidamide;(3R)-1-[4-[(3-fluorophenyl)methoxy]phenyl]-5-oxopyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 160501661 |
| Molecular Formula | C36H33F2N5O5 |
| Molecular Weight | 653.69 g/mol |
| Exact Mass | 653.24 |
| IUPAC Name | (3R)-1-[4-[(3-fluorophenyl)methoxy]phenyl]-N'-hydroxy-5-oxopyrrolidine-3-carboximidamide;(3R)-1-[4-[(3-fluorophenyl)methoxy]phenyl]-5-oxopyrrolidine-3-carbonitrile |
| SMILES | N#C[C@@H]1CC(=O)N(c2ccc(OCc3cccc(F)c3)cc2)C1.NC(=NO)[C@@H]1CC(=O)N(c2ccc(OCc3cccc(F)c3)cc2)C1 |
| InChI | InChI=1S/C18H18FN3O3.C18H15FN2O2/c19-14-3-1-2-12(8-14)11-25-16-6-4-15(5-7-16)22-10-13(9-17(22)23)18(20)21-24;19-15-3-1-2-13(8-15)12-23-17-6-4-16(5-7-17)21-11-14(10-20)9-18(21)22/h1-8,13,24H,9-11H2,(H2,20,21);1-8,14H,9,11-12H2/t13-;14-/m10/s1 |
| InChIKey | QRWAYBGBVJHANU-KHAUVTNHSA-N |
| XLogP | 5.79 |
| TPSA | 141.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.69 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|