C20H22N2O4 — CID 68614064
(3S)-1-[4-[(3-methoxyphenyl)methoxy]phenyl]-N-methyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 68614064) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is (3S)-1-[4-[(3-methoxyphenyl)methoxy]phenyl]-N-methyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-[4-[(3-methoxyphenyl)methoxy]phenyl]-N-methyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 68614064 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (3S)-1-[4-[(3-methoxyphenyl)methoxy]phenyl]-N-methyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | CNC(=O)[C@H]1CC(=O)N(c2ccc(OCc3cccc(OC)c3)cc2)C1 |
| InChI | InChI=1S/C20H22N2O4/c1-21-20(24)15-11-19(23)22(12-15)16-6-8-17(9-7-16)26-13-14-4-3-5-18(10-14)25-2/h3-10,15H,11-13H2,1-2H3,(H,21,24)/t15-/m0/s1 |
| InChIKey | RRJHKZYWZMNUKR-HNNXBMFYSA-N |
| XLogP | 2.37 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |