C24H19N — CID 101497123
(2S,5S)-2,5-dinaphthalen-2-yl-2,5-dihydro-1H-pyrrole (PubChem CID 101497123) has the molecular formula C24H19N and a molecular weight of 321.42 g/mol. Its IUPAC name is (2S,5S)-2,5-dinaphthalen-2-yl-2,5-dihydro-1H-pyrrole.
| Compound Name | (2S,5S)-2,5-dinaphthalen-2-yl-2,5-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 101497123 |
| Molecular Formula | C24H19N |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | (2S,5S)-2,5-dinaphthalen-2-yl-2,5-dihydro-1H-pyrrole |
| SMILES | C1=C[C@@H](c2ccc3ccccc3c2)N[C@@H]1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H19N/c1-3-7-19-15-21(11-9-17(19)5-1)23-13-14-24(25-23)22-12-10-18-6-2-4-8-20(18)16-22/h1-16,23-25H/t23-,24-/m0/s1 |
| InChIKey | LOLNFZODISPNDB-ZEQRLZLVSA-N |
| XLogP | 5.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|