C13H16O4S — CID 101497181
methyl (2S,3S)-1,1-dioxo-3-phenylthiane-2-carboxylate (PubChem CID 101497181) has the molecular formula C13H16O4S and a molecular weight of 268.33 g/mol. Its IUPAC name is methyl (2S,3S)-1,1-dioxo-3-phenylthiane-2-carboxylate.
| Compound Name | methyl (2S,3S)-1,1-dioxo-3-phenylthiane-2-carboxylate |
|---|---|
| PubChem CID | 101497181 |
| Molecular Formula | C13H16O4S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | methyl (2S,3S)-1,1-dioxo-3-phenylthiane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](c2ccccc2)CCCS1(=O)=O |
| InChI | InChI=1S/C13H16O4S/c1-17-13(14)12-11(8-5-9-18(12,15)16)10-6-3-2-4-7-10/h2-4,6-7,11-12H,5,8-9H2,1H3/t11-,12-/m0/s1 |
| InChIKey | AHWNBGSYJVDQFK-RYUDHWBXSA-N |
| XLogP | 1.52 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |