C19H15N5O — CID 10149852
N-[2-(4-aminophenyl)-3H-benzimidazol-5-yl]pyridine-2-carboxamide (PubChem CID 10149852) has the molecular formula C19H15N5O and a molecular weight of 329.36 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)-3H-benzimidazol-5-yl]pyridine-2-carboxamide.
| Compound Name | N-[2-(4-aminophenyl)-3H-benzimidazol-5-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 10149852 |
| Molecular Formula | C19H15N5O |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | N-[2-(4-aminophenyl)-3H-benzimidazol-5-yl]pyridine-2-carboxamide |
| SMILES | Nc1ccc(-c2nc3ccc(NC(=O)c4ccccn4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C19H15N5O/c20-13-6-4-12(5-7-13)18-23-15-9-8-14(11-17(15)24-18)22-19(25)16-3-1-2-10-21-16/h1-11H,20H2,(H,22,25)(H,23,24) |
| InChIKey | RPEMOCZBXQDKAJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|