C18H14N6O — CID 23730002
2-(4-aminophenyl)-N-pyridin-2-yl-3H-imidazo[4,5-c]pyridine-6-carboxamide (PubChem CID 23730002) has the molecular formula C18H14N6O and a molecular weight of 330.35 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-pyridin-2-yl-3H-imidazo[4,5-c]pyridine-6-carboxamide.
| Compound Name | 2-(4-aminophenyl)-N-pyridin-2-yl-3H-imidazo[4,5-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 23730002 |
| Molecular Formula | C18H14N6O |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2-(4-aminophenyl)-N-pyridin-2-yl-3H-imidazo[4,5-c]pyridine-6-carboxamide |
| SMILES | Nc1ccc(-c2nc3cc(C(=O)Nc4ccccn4)ncc3[nH]2)cc1 |
| InChI | InChI=1S/C18H14N6O/c19-12-6-4-11(5-7-12)17-22-13-9-14(21-10-15(13)23-17)18(25)24-16-3-1-2-8-20-16/h1-10H,19H2,(H,22,23)(H,20,24,25) |
| InChIKey | FGTZMZRERARPND-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|