C30H29N5O2 — CID 11488738
2-[4-(1-adamantylcarbamoyl)phenyl]-N-pyridin-2-yl-3H-benzimidazole-5-carboxamide (PubChem CID 11488738) has the molecular formula C30H29N5O2 and a molecular weight of 491.60 g/mol. Its IUPAC name is 2-[4-(1-adamantylcarbamoyl)phenyl]-N-pyridin-2-yl-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-[4-(1-adamantylcarbamoyl)phenyl]-N-pyridin-2-yl-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 11488738 |
| Molecular Formula | C30H29N5O2 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 2-[4-(1-adamantylcarbamoyl)phenyl]-N-pyridin-2-yl-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(Nc1ccccn1)c1ccc2nc(-c3ccc(C(=O)NC45CC6CC(CC(C6)C4)C5)cc3)[nH]c2c1 |
| InChI | InChI=1S/C30H29N5O2/c36-28(34-26-3-1-2-10-31-26)23-8-9-24-25(14-23)33-27(32-24)21-4-6-22(7-5-21)29(37)35-30-15-18-11-19(16-30)13-20(12-18)17-30/h1-10,14,18-20H,11-13,15-17H2,(H,32,33)(H,35,37)(H,31,34,36) |
| InChIKey | CNPORFDJAYYWPB-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |