C35H40N4O2 — CID 11318815
N-[2-[4-(1-adamantylcarbamoyl)phenyl]-3H-benzimidazol-5-yl]adamantane-1-carboxamide (PubChem CID 11318815) has the molecular formula C35H40N4O2 and a molecular weight of 548.73 g/mol. Its IUPAC name is N-[2-[4-(1-adamantylcarbamoyl)phenyl]-3H-benzimidazol-5-yl]adamantane-1-carboxamide.
| Compound Name | N-[2-[4-(1-adamantylcarbamoyl)phenyl]-3H-benzimidazol-5-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 11318815 |
| Molecular Formula | C35H40N4O2 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.32 |
| IUPAC Name | N-[2-[4-(1-adamantylcarbamoyl)phenyl]-3H-benzimidazol-5-yl]adamantane-1-carboxamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1ccc(-c2nc3ccc(NC(=O)C45CC6CC(CC(C6)C4)C5)cc3[nH]2)cc1 |
| InChI | InChI=1S/C35H40N4O2/c40-32(39-35-17-23-10-24(18-35)12-25(11-23)19-35)27-3-1-26(2-4-27)31-37-29-6-5-28(13-30(29)38-31)36-33(41)34-14-20-7-21(15-34)9-22(8-20)16-34/h1-6,13,20-25H,7-12,14-19H2,(H,36,41)(H,37,38)(H,39,40) |
| InChIKey | RWAYCXYMXUOPKW-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |