C35H40N4O3 — CID 4105919
N-[3-[6-(adamantane-1-carbonylamino)-1H-benzimidazol-2-yl]-4-hydroxyphenyl]adamantane-1-carboxamide (PubChem CID 4105919) has the molecular formula C35H40N4O3 and a molecular weight of 564.73 g/mol. Its IUPAC name is N-[3-[6-(adamantane-1-carbonylamino)-1H-benzimidazol-2-yl]-4-hydroxyphenyl]adamantane-1-carboxamide.
| Compound Name | N-[3-[6-(adamantane-1-carbonylamino)-1H-benzimidazol-2-yl]-4-hydroxyphenyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 4105919 |
| Molecular Formula | C35H40N4O3 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | N-[3-[6-(adamantane-1-carbonylamino)-1H-benzimidazol-2-yl]-4-hydroxyphenyl]adamantane-1-carboxamide |
| SMILES | O=C(Nc1ccc(O)c(-c2nc3ccc(NC(=O)C45CC6CC(CC(C6)C4)C5)cc3[nH]2)c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C35H40N4O3/c40-30-4-2-25(36-32(41)34-13-19-5-20(14-34)7-21(6-19)15-34)11-27(30)31-38-28-3-1-26(12-29(28)39-31)37-33(42)35-16-22-8-23(17-35)10-24(9-22)18-35/h1-4,11-12,19-24,40H,5-10,13-18H2,(H,36,41)(H,37,42)(H,38,39) |
| InChIKey | MFBFFWITVQRYKK-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|