C32H36N4O2 — CID 142169310
N-(1-adamantyl)-4-[6-[(4-methylidenecyclohexanecarbonyl)amino]-1H-benzimidazol-2-yl]benzamide (PubChem CID 142169310) has the molecular formula C32H36N4O2 and a molecular weight of 508.67 g/mol. Its IUPAC name is N-(1-adamantyl)-4-[6-[(4-methylidenecyclohexanecarbonyl)amino]-1H-benzimidazol-2-yl]benzamide.
| Compound Name | N-(1-adamantyl)-4-[6-[(4-methylidenecyclohexanecarbonyl)amino]-1H-benzimidazol-2-yl]benzamide |
|---|---|
| PubChem CID | 142169310 |
| Molecular Formula | C32H36N4O2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | N-(1-adamantyl)-4-[6-[(4-methylidenecyclohexanecarbonyl)amino]-1H-benzimidazol-2-yl]benzamide |
| SMILES | C=C1CCC(C(=O)Nc2ccc3nc(-c4ccc(C(=O)NC56CC7CC(CC(C7)C5)C6)cc4)[nH]c3c2)CC1 |
| InChI | InChI=1S/C32H36N4O2/c1-19-2-4-24(5-3-19)30(37)33-26-10-11-27-28(15-26)35-29(34-27)23-6-8-25(9-7-23)31(38)36-32-16-20-12-21(17-32)14-22(13-20)18-32/h6-11,15,20-22,24H,1-5,12-14,16-18H2,(H,33,37)(H,34,35)(H,36,38) |
| InChIKey | CZMUDFIXEJPXJS-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|