C28H34N4O2 — CID 142169240
N-cyclooctyl-4-[6-(cyclopentanecarbonylamino)-1H-benzimidazol-2-yl]benzamide (PubChem CID 142169240) has the molecular formula C28H34N4O2 and a molecular weight of 458.61 g/mol. Its IUPAC name is N-cyclooctyl-4-[6-(cyclopentanecarbonylamino)-1H-benzimidazol-2-yl]benzamide.
| Compound Name | N-cyclooctyl-4-[6-(cyclopentanecarbonylamino)-1H-benzimidazol-2-yl]benzamide |
|---|---|
| PubChem CID | 142169240 |
| Molecular Formula | C28H34N4O2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | N-cyclooctyl-4-[6-(cyclopentanecarbonylamino)-1H-benzimidazol-2-yl]benzamide |
| SMILES | O=C(NC1CCCCCCC1)c1ccc(-c2nc3ccc(NC(=O)C4CCCC4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C28H34N4O2/c33-27(20-8-6-7-9-20)30-23-16-17-24-25(18-23)32-26(31-24)19-12-14-21(15-13-19)28(34)29-22-10-4-2-1-3-5-11-22/h12-18,20,22H,1-11H2,(H,29,34)(H,30,33)(H,31,32) |
| InChIKey | DWVUQXPAXSQVHN-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |