C30H33N5O3 — CID 142169238
N-cyclooctyl-2-[4-[[4-(methoxyamino)benzoyl]amino]phenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 142169238) has the molecular formula C30H33N5O3 and a molecular weight of 511.63 g/mol. Its IUPAC name is N-cyclooctyl-2-[4-[[4-(methoxyamino)benzoyl]amino]phenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-cyclooctyl-2-[4-[[4-(methoxyamino)benzoyl]amino]phenyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 142169238 |
| Molecular Formula | C30H33N5O3 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | N-cyclooctyl-2-[4-[[4-(methoxyamino)benzoyl]amino]phenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | CONc1ccc(C(=O)Nc2ccc(-c3nc4ccc(C(=O)NC5CCCCCCC5)cc4[nH]3)cc2)cc1 |
| InChI | InChI=1S/C30H33N5O3/c1-38-35-25-16-11-21(12-17-25)29(36)32-24-14-9-20(10-15-24)28-33-26-18-13-22(19-27(26)34-28)30(37)31-23-7-5-3-2-4-6-8-23/h9-19,23,35H,2-8H2,1H3,(H,31,37)(H,32,36)(H,33,34) |
| InChIKey | NATWMRBMYFEXLK-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 108.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|