C32H38N4O2 — CID 20740045
N-(2-adamantyl)-2-[4-(cycloheptylcarbamoyl)phenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 20740045) has the molecular formula C32H38N4O2 and a molecular weight of 510.68 g/mol. Its IUPAC name is N-(2-adamantyl)-2-[4-(cycloheptylcarbamoyl)phenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-(2-adamantyl)-2-[4-(cycloheptylcarbamoyl)phenyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 20740045 |
| Molecular Formula | C32H38N4O2 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | N-(2-adamantyl)-2-[4-(cycloheptylcarbamoyl)phenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(NC1CCCCCC1)c1ccc(-c2nc3ccc(C(=O)NC4C5CC6CC(C5)CC4C6)cc3[nH]2)cc1 |
| InChI | InChI=1S/C32H38N4O2/c37-31(33-26-5-3-1-2-4-6-26)22-9-7-21(8-10-22)30-34-27-12-11-23(18-28(27)35-30)32(38)36-29-24-14-19-13-20(16-24)17-25(29)15-19/h7-12,18-20,24-26,29H,1-6,13-17H2,(H,33,37)(H,34,35)(H,36,38) |
| InChIKey | NLTKKBOJRAFUFC-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |