C28H34N4O2 — CID 20739970
2-[4-(cyclohexylcarbamoyl)phenyl]-N-(2-methylcyclohexyl)-3H-benzimidazole-5-carboxamide (PubChem CID 20739970) has the molecular formula C28H34N4O2 and a molecular weight of 458.61 g/mol. Its IUPAC name is 2-[4-(cyclohexylcarbamoyl)phenyl]-N-(2-methylcyclohexyl)-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-[4-(cyclohexylcarbamoyl)phenyl]-N-(2-methylcyclohexyl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 20739970 |
| Molecular Formula | C28H34N4O2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 2-[4-(cyclohexylcarbamoyl)phenyl]-N-(2-methylcyclohexyl)-3H-benzimidazole-5-carboxamide |
| SMILES | CC1CCCCC1NC(=O)c1ccc2nc(-c3ccc(C(=O)NC4CCCCC4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C28H34N4O2/c1-18-7-5-6-10-23(18)32-28(34)21-15-16-24-25(17-21)31-26(30-24)19-11-13-20(14-12-19)27(33)29-22-8-3-2-4-9-22/h11-18,22-23H,2-10H2,1H3,(H,29,33)(H,30,31)(H,32,34) |
| InChIKey | ROTCINVJRJKGKH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |