C29H34N4O2 — CID 142169327
N-cyclohexyl-2-[4-[(2-ethenylcyclohexyl)carbamoyl]phenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 142169327) has the molecular formula C29H34N4O2 and a molecular weight of 470.62 g/mol. Its IUPAC name is N-cyclohexyl-2-[4-[(2-ethenylcyclohexyl)carbamoyl]phenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-cyclohexyl-2-[4-[(2-ethenylcyclohexyl)carbamoyl]phenyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 142169327 |
| Molecular Formula | C29H34N4O2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | N-cyclohexyl-2-[4-[(2-ethenylcyclohexyl)carbamoyl]phenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | C=CC1CCCCC1NC(=O)c1ccc(-c2nc3ccc(C(=O)NC4CCCCC4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C29H34N4O2/c1-2-19-8-6-7-11-24(19)33-28(34)21-14-12-20(13-15-21)27-31-25-17-16-22(18-26(25)32-27)29(35)30-23-9-4-3-5-10-23/h2,12-19,23-24H,1,3-11H2,(H,30,35)(H,31,32)(H,33,34) |
| InChIKey | IGFBXQKPMMODKL-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|