C35H44N4O2 — CID 89329690
2-[4-[[(3R)-1,3-bis(prop-2-enyl)cyclooctyl]carbamoyl]phenyl]-N-cyclohexyl-3H-benzimidazole-5-carboxamide (PubChem CID 89329690) has the molecular formula C35H44N4O2 and a molecular weight of 552.76 g/mol. Its IUPAC name is 2-[4-[[(3R)-1,3-bis(prop-2-enyl)cyclooctyl]carbamoyl]phenyl]-N-cyclohexyl-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-[4-[[(3R)-1,3-bis(prop-2-enyl)cyclooctyl]carbamoyl]phenyl]-N-cyclohexyl-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 89329690 |
| Molecular Formula | C35H44N4O2 |
| Molecular Weight | 552.76 g/mol |
| Exact Mass | 552.35 |
| IUPAC Name | 2-[4-[[(3R)-1,3-bis(prop-2-enyl)cyclooctyl]carbamoyl]phenyl]-N-cyclohexyl-3H-benzimidazole-5-carboxamide |
| SMILES | C=CC[C@H]1CCCCCC(CC=C)(NC(=O)c2ccc(-c3nc4ccc(C(=O)NC5CCCCC5)cc4[nH]3)cc2)C1 |
| InChI | InChI=1S/C35H44N4O2/c1-3-11-25-12-7-6-10-22-35(24-25,21-4-2)39-34(41)27-17-15-26(16-18-27)32-37-30-20-19-28(23-31(30)38-32)33(40)36-29-13-8-5-9-14-29/h3-4,15-20,23,25,29H,1-2,5-14,21-22,24H2,(H,36,40)(H,37,38)(H,39,41)/t25-,35?/m0/s1 |
| InChIKey | NOIAUQPSXMFJQY-LLIHCOLESA-N |
| XLogP | 7.88 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.76 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|