C15H14N6O — CID 82211721
2-[5-(4-aminophenyl)triazol-1-yl]-N-pyridin-2-ylacetamide (PubChem CID 82211721) has the molecular formula C15H14N6O and a molecular weight of 294.32 g/mol. Its IUPAC name is 2-[5-(4-aminophenyl)triazol-1-yl]-N-pyridin-2-ylacetamide.
| Compound Name | 2-[5-(4-aminophenyl)triazol-1-yl]-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 82211721 |
| Molecular Formula | C15H14N6O |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-[5-(4-aminophenyl)triazol-1-yl]-N-pyridin-2-ylacetamide |
| SMILES | Nc1ccc(-c2cnnn2CC(=O)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C15H14N6O/c16-12-6-4-11(5-7-12)13-9-18-20-21(13)10-15(22)19-14-3-1-2-8-17-14/h1-9H,10,16H2,(H,17,19,22) |
| InChIKey | KDUOKAQCAPBXKW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|