C14H16F3NO — CID 101499208
4-[(E,1R)-4,4,4-trifluoro-1-phenylbut-2-enyl]morpholine (PubChem CID 101499208) has the molecular formula C14H16F3NO and a molecular weight of 271.28 g/mol. Its IUPAC name is 4-[(E,1R)-4,4,4-trifluoro-1-phenylbut-2-enyl]morpholine.
| Compound Name | 4-[(E,1R)-4,4,4-trifluoro-1-phenylbut-2-enyl]morpholine |
|---|---|
| PubChem CID | 101499208 |
| Molecular Formula | C14H16F3NO |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-[(E,1R)-4,4,4-trifluoro-1-phenylbut-2-enyl]morpholine |
| SMILES | FC(F)(F)/C=C/[C@H](c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C14H16F3NO/c15-14(16,17)7-6-13(12-4-2-1-3-5-12)18-8-10-19-11-9-18/h1-7,13H,8-11H2/b7-6+/t13-/m1/s1 |
| InChIKey | DCBTULMHNZYORE-KTRBRXNASA-N |
| XLogP | 3.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|