C12H11Cl2N3O3S — CID 10150058
3-chloro-N-(6-chloro-3-methoxypyrazin-2-yl)-2-methylbenzenesulfonamide (PubChem CID 10150058) has the molecular formula C12H11Cl2N3O3S and a molecular weight of 348.21 g/mol. Its IUPAC name is 3-chloro-N-(6-chloro-3-methoxypyrazin-2-yl)-2-methylbenzenesulfonamide.
| Compound Name | 3-chloro-N-(6-chloro-3-methoxypyrazin-2-yl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10150058 |
| Molecular Formula | C12H11Cl2N3O3S |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | 3-chloro-N-(6-chloro-3-methoxypyrazin-2-yl)-2-methylbenzenesulfonamide |
| SMILES | COc1ncc(Cl)nc1NS(=O)(=O)c1cccc(Cl)c1C |
| InChI | InChI=1S/C12H11Cl2N3O3S/c1-7-8(13)4-3-5-9(7)21(18,19)17-11-12(20-2)15-6-10(14)16-11/h3-6H,1-2H3,(H,16,17) |
| InChIKey | NGXBSWMIRJRADL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |