C25H22Cl2N2O — CID 10151319
3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-5H-phenanthridin-6-one;hydrochloride (PubChem CID 10151319) has the molecular formula C25H22Cl2N2O and a molecular weight of 437.37 g/mol. Its IUPAC name is 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-5H-phenanthridin-6-one;hydrochloride.
| Compound Name | 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-5H-phenanthridin-6-one;hydrochloride |
|---|---|
| PubChem CID | 10151319 |
| Molecular Formula | C25H22Cl2N2O |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-5H-phenanthridin-6-one;hydrochloride |
| SMILES | Cl.O=c1[nH]c2cc(CN3CC=C(c4ccc(Cl)cc4)CC3)ccc2c2ccccc12 |
| InChI | InChI=1S/C25H21ClN2O.ClH/c26-20-8-6-18(7-9-20)19-11-13-28(14-12-19)16-17-5-10-22-21-3-1-2-4-23(21)25(29)27-24(22)15-17;/h1-11,15H,12-14,16H2,(H,27,29);1H |
| InChIKey | UICUPMQFYTVZNV-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|