C26H22F3N3O5 — CID 10152490
[(3aR,5R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl] N-benzylcarbamate (PubChem CID 10152490) has the molecular formula C26H22F3N3O5 and a molecular weight of 513.47 g/mol. Its IUPAC name is [(3aR,5R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl] N-benzylcarbamate.
| Compound Name | [(3aR,5R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl] N-benzylcarbamate |
|---|---|
| PubChem CID | 10152490 |
| Molecular Formula | C26H22F3N3O5 |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | [(3aR,5R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl] N-benzylcarbamate |
| SMILES | CC12C[C@@H](OC(=O)NCc3ccccc3)C(C)(O1)[C@@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C26H22F3N3O5/c1-24-11-18(36-23(35)31-13-14-6-4-3-5-7-14)25(2,37-24)20-19(24)21(33)32(22(20)34)16-9-8-15(12-30)17(10-16)26(27,28)29/h3-10,18-20H,11,13H2,1-2H3,(H,31,35)/t18-,19-,20+,24?,25?/m1/s1 |
| InChIKey | KNCSJGKAQXAKTD-HUWOBIQISA-N |
| XLogP | 3.93 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|