C32H34N2O7S — CID 10153196
3-(2,1,3-benzothiadiazol-5-yl)-4-[(4-hexoxy-3,5-dimethoxyphenyl)methyl]-5-hydroxy-5-(4-methoxyphenyl)furan-2-one (PubChem CID 10153196) has the molecular formula C32H34N2O7S and a molecular weight of 590.70 g/mol. Its IUPAC name is 3-(2,1,3-benzothiadiazol-5-yl)-4-[(4-hexoxy-3,5-dimethoxyphenyl)methyl]-5-hydroxy-5-(4-methoxyphenyl)furan-2-one.
| Compound Name | 3-(2,1,3-benzothiadiazol-5-yl)-4-[(4-hexoxy-3,5-dimethoxyphenyl)methyl]-5-hydroxy-5-(4-methoxyphenyl)furan-2-one |
|---|---|
| PubChem CID | 10153196 |
| Molecular Formula | C32H34N2O7S |
| Molecular Weight | 590.70 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | 3-(2,1,3-benzothiadiazol-5-yl)-4-[(4-hexoxy-3,5-dimethoxyphenyl)methyl]-5-hydroxy-5-(4-methoxyphenyl)furan-2-one |
| SMILES | CCCCCCOc1c(OC)cc(CC2=C(c3ccc4nsnc4c3)C(=O)OC2(O)c2ccc(OC)cc2)cc1OC |
| InChI | InChI=1S/C32H34N2O7S/c1-5-6-7-8-15-40-30-27(38-3)17-20(18-28(30)39-4)16-24-29(21-9-14-25-26(19-21)34-42-33-25)31(35)41-32(24,36)22-10-12-23(37-2)13-11-22/h9-14,17-19,36H,5-8,15-16H2,1-4H3 |
| InChIKey | JHXFGLSDXQPDDG-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.70 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|