C3H6N4 — CID 10154007
1H-pyrazole-4,5-diamine (PubChem CID 10154007) has the molecular formula C3H6N4 and a molecular weight of 98.11 g/mol. Its IUPAC name is 1H-pyrazole-4,5-diamine.
| Compound Name | 1H-pyrazole-4,5-diamine |
|---|---|
| PubChem CID | 10154007 |
| Molecular Formula | C3H6N4 |
| Molecular Weight | 98.11 g/mol |
| Exact Mass | 98.06 |
| IUPAC Name | 1H-pyrazole-4,5-diamine |
| SMILES | Nc1cn[nH]c1N |
| InChI | InChI=1S/C3H6N4/c4-2-1-6-7-3(2)5/h1H,4H2,(H3,5,6,7) |
| InChIKey | LHGQFZQWSOXLEW-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.11 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |