About [(2S)-3-amino-2-hydroxypropyl]-hydroxy-oxophosphanium;naphthalene-2-sulfonic acid
[(2S)-3-amino-2-hydroxypropyl]-hydroxy-oxophosphanium;naphthalene-2-sulfonic acid (PubChem CID 10154700) has the molecular formula C13H17NO6PS+
and a molecular weight of 346.32 g/mol. Its IUPAC name is [(2S)-3-amino-2-hydroxypropyl]-hydroxy-oxophosphanium;naphthalene-2-sulfonic acid.
Molecular Properties
| Compound Name | [(2S)-3-amino-2-hydroxypropyl]-hydroxy-oxophosphanium;naphthalene-2-sulfonic acid |
| PubChem CID | 10154700 |
| Molecular Formula | C13H17NO6PS+ |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | [(2S)-3-amino-2-hydroxypropyl]-hydroxy-oxophosphanium;naphthalene-2-sulfonic acid |
| SMILES | NC[C@H](O)C[P+](=O)O.O=S(=O)(O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8O3S.C3H8NO3P/c11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10;4-1-3(5)2-8(6)7/h1-7H,(H,11,12,13);3,5H,1-2,4H2/p+1/t;3-/m.0/s1 |
| InChIKey | VLYUVGJXKDXAID-HVDRVSQOSA-O |
| XLogP | 1.13 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-3-amino-2-hydroxypropyl]-hydroxy-oxophosphanium;naphthalene-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-3-amino-2-hydroxypropyl]-hydroxy-oxophosphanium;naphthalene-2-sulfonic acid?
The IUPAC name of [(2S)-3-amino-2-hydroxypropyl]-hydroxy-oxophosphanium;naphthalene-2-sulfonic acid (CID 10154700) is [(2S)-3-amino-2-hydroxypropyl]-hydroxy-oxophosphanium;naphthalene-2-sulfonic acid.
What is the SMILES notation for [(2S)-3-amino-2-hydroxypropyl]-hydroxy-oxophosphanium;naphthalene-2-sulfonic acid?
The canonical SMILES for [(2S)-3-amino-2-hydroxypropyl]-hydroxy-oxophosphanium;naphthalene-2-sulfonic acid is NC[C@H](O)C[P+](=O)O.O=S(=O)(O)c1ccc2ccccc2c1.
What is the InChIKey of [(2S)-3-amino-2-hydroxypropyl]-hydroxy-oxophosphanium;naphthalene-2-sulfonic acid?
The InChIKey is VLYUVGJXKDXAID-HVDRVSQOSA-O. The full InChI is InChI=1S/C10H8O3S.C3H8NO3P/c11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10;4-1-3(5)2-8(6)7/h1-7H,(H,11,12,13);3,5H,1-2,4H2/p+1/t;3-/m.0/s1.
What are the key properties of [(2S)-3-amino-2-hydroxypropyl]-hydroxy-oxophosphanium;naphthalene-2-sulfonic acid?
[(2S)-3-amino-2-hydroxypropyl]-hydroxy-oxophosphanium;naphthalene-2-sulfonic acid has a molecular weight of 346.32 g/mol, XLogP of 1.13, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-3-amino-2-hydroxypropyl]-hydroxy-oxophosphanium;naphthalene-2-sulfonic acid is sourced from PubChem (CID 10154700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).