C16H25N5O4 — CID 10154942
6-acetyl-2-[(5R)-5-hydroxyhexyl]-4-methyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione (PubChem CID 10154942) has the molecular formula C16H25N5O4 and a molecular weight of 351.41 g/mol. Its IUPAC name is 6-acetyl-2-[(5R)-5-hydroxyhexyl]-4-methyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-acetyl-2-[(5R)-5-hydroxyhexyl]-4-methyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 10154942 |
| Molecular Formula | C16H25N5O4 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 6-acetyl-2-[(5R)-5-hydroxyhexyl]-4-methyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione |
| SMILES | CC(=O)N1CCN2C1=NC1C2C(=O)N(CCCC[C@@H](C)O)C(=O)N1C |
| InChI | InChI=1S/C16H25N5O4/c1-10(22)6-4-5-7-21-14(24)12-13(18(3)16(21)25)17-15-19(11(2)23)8-9-20(12)15/h10,12-13,22H,4-9H2,1-3H3/t10-,12?,13?/m1/s1 |
| InChIKey | MAAGVVHZGGQXFJ-QFWMXSHPSA-N |
| XLogP | -0.34 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|