C16H28N4O3 — CID 141439481
5-ethyl-1-(5-hydroxyheptyl)-3,7-dimethyl-4H-purine-2,6-dione (PubChem CID 141439481) has the molecular formula C16H28N4O3 and a molecular weight of 324.43 g/mol. Its IUPAC name is 5-ethyl-1-(5-hydroxyheptyl)-3,7-dimethyl-4H-purine-2,6-dione.
| Compound Name | 5-ethyl-1-(5-hydroxyheptyl)-3,7-dimethyl-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 141439481 |
| Molecular Formula | C16H28N4O3 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 5-ethyl-1-(5-hydroxyheptyl)-3,7-dimethyl-4H-purine-2,6-dione |
| SMILES | CCC(O)CCCCN1C(=O)N(C)C2N=CN(C)C2(CC)C1=O |
| InChI | InChI=1S/C16H28N4O3/c1-5-12(21)9-7-8-10-20-14(22)16(6-2)13(17-11-18(16)3)19(4)15(20)23/h11-13,21H,5-10H2,1-4H3 |
| InChIKey | MSKGZTSXQMWZTG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|