C17H27N5O4 — CID 10270201
9-acetyl-3-[(5R)-5-hydroxyhexyl]-1-methyl-6,7,8,10a-tetrahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione (PubChem CID 10270201) has the molecular formula C17H27N5O4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 9-acetyl-3-[(5R)-5-hydroxyhexyl]-1-methyl-6,7,8,10a-tetrahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione.
| Compound Name | 9-acetyl-3-[(5R)-5-hydroxyhexyl]-1-methyl-6,7,8,10a-tetrahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10270201 |
| Molecular Formula | C17H27N5O4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 9-acetyl-3-[(5R)-5-hydroxyhexyl]-1-methyl-6,7,8,10a-tetrahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione |
| SMILES | CC(=O)N1CCCN2C1=NC1C2C(=O)N(CCCC[C@@H](C)O)C(=O)N1C |
| InChI | InChI=1S/C17H27N5O4/c1-11(23)7-4-5-8-22-15(25)13-14(19(3)17(22)26)18-16-20(12(2)24)9-6-10-21(13)16/h11,13-14,23H,4-10H2,1-3H3/t11-,13?,14?/m1/s1 |
| InChIKey | PRPLVBAAJLGHNV-LMWSTFAQSA-N |
| XLogP | 0.05 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|