C19H34Cl2N2 — CID 10155485
1-(azepan-1-yl)-3-(4-tert-butylphenyl)propan-2-amine;dihydrochloride (PubChem CID 10155485) has the molecular formula C19H34Cl2N2 and a molecular weight of 361.40 g/mol. Its IUPAC name is 1-(azepan-1-yl)-3-(4-tert-butylphenyl)propan-2-amine;dihydrochloride.
| Compound Name | 1-(azepan-1-yl)-3-(4-tert-butylphenyl)propan-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 10155485 |
| Molecular Formula | C19H34Cl2N2 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 1-(azepan-1-yl)-3-(4-tert-butylphenyl)propan-2-amine;dihydrochloride |
| SMILES | CC(C)(C)c1ccc(CC(N)CN2CCCCCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C19H32N2.2ClH/c1-19(2,3)17-10-8-16(9-11-17)14-18(20)15-21-12-6-4-5-7-13-21;;/h8-11,18H,4-7,12-15,20H2,1-3H3;2*1H |
| InChIKey | LOQPJXJJDLZCIQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |