C18H29N — CID 73116860
1-[2-(4-tert-butylphenyl)propyl]piperidine (PubChem CID 73116860) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is 1-[2-(4-tert-butylphenyl)propyl]piperidine.
| Compound Name | 1-[2-(4-tert-butylphenyl)propyl]piperidine |
|---|---|
| PubChem CID | 73116860 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 1-[2-(4-tert-butylphenyl)propyl]piperidine |
| SMILES | CC(CN1CCCCC1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H29N/c1-15(14-19-12-6-5-7-13-19)16-8-10-17(11-9-16)18(2,3)4/h8-11,15H,5-7,12-14H2,1-4H3 |
| InChIKey | VMYKSDCCQJBKRS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |