C18H14Cl2N2OS — CID 10156413
(NE)-N-[[2-chloro-4-(2-methylanilino)phenyl]-(3-chlorothiophen-2-yl)methylidene]hydroxylamine (PubChem CID 10156413) has the molecular formula C18H14Cl2N2OS and a molecular weight of 377.30 g/mol. Its IUPAC name is (NE)-N-[[2-chloro-4-(2-methylanilino)phenyl]-(3-chlorothiophen-2-yl)methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[2-chloro-4-(2-methylanilino)phenyl]-(3-chlorothiophen-2-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 10156413 |
| Molecular Formula | C18H14Cl2N2OS |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | (NE)-N-[[2-chloro-4-(2-methylanilino)phenyl]-(3-chlorothiophen-2-yl)methylidene]hydroxylamine |
| SMILES | Cc1ccccc1Nc1ccc(/C(=N\O)c2sccc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H14Cl2N2OS/c1-11-4-2-3-5-16(11)21-12-6-7-13(15(20)10-12)17(22-23)18-14(19)8-9-24-18/h2-10,21,23H,1H3/b22-17+ |
| InChIKey | NGGXHLOVMDGWCX-OQKWZONESA-N |
| XLogP | 6.33 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|