C20H26BCl2NO — CID 10156477
N-[2-bis(3-chloro-4-methylphenyl)boranyloxyethyl]butan-1-amine (PubChem CID 10156477) has the molecular formula C20H26BCl2NO and a molecular weight of 378.15 g/mol. Its IUPAC name is N-[2-bis(3-chloro-4-methylphenyl)boranyloxyethyl]butan-1-amine.
| Compound Name | N-[2-bis(3-chloro-4-methylphenyl)boranyloxyethyl]butan-1-amine |
|---|---|
| PubChem CID | 10156477 |
| Molecular Formula | C20H26BCl2NO |
| Molecular Weight | 378.15 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-[2-bis(3-chloro-4-methylphenyl)boranyloxyethyl]butan-1-amine |
| SMILES | CCCCNCCOB(c1ccc(C)c(Cl)c1)c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C20H26BCl2NO/c1-4-5-10-24-11-12-25-21(17-8-6-15(2)19(22)13-17)18-9-7-16(3)20(23)14-18/h6-9,13-14,24H,4-5,10-12H2,1-3H3 |
| InChIKey | PEJQNVKUZQDVTK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.15 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|