C20H25Cl2N — CID 173069092
N-[2,2-bis(3-chloro-4-methylphenyl)ethyl]butan-1-amine (PubChem CID 173069092) has the molecular formula C20H25Cl2N and a molecular weight of 350.33 g/mol. Its IUPAC name is N-[2,2-bis(3-chloro-4-methylphenyl)ethyl]butan-1-amine.
| Compound Name | N-[2,2-bis(3-chloro-4-methylphenyl)ethyl]butan-1-amine |
|---|---|
| PubChem CID | 173069092 |
| Molecular Formula | C20H25Cl2N |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N-[2,2-bis(3-chloro-4-methylphenyl)ethyl]butan-1-amine |
| SMILES | CCCCNCC(c1ccc(C)c(Cl)c1)c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C20H25Cl2N/c1-4-5-10-23-13-18(16-8-6-14(2)19(21)11-16)17-9-7-15(3)20(22)12-17/h6-9,11-12,18,23H,4-5,10,13H2,1-3H3 |
| InChIKey | UEHCAXBOSZUSCC-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|