C22H19F2N3O — CID 10158808
N-[[5-(2,4-difluorophenyl)-3-pyridinyl]methyl]-2-(1H-indol-7-yloxy)ethanamine (PubChem CID 10158808) has the molecular formula C22H19F2N3O and a molecular weight of 379.41 g/mol. Its IUPAC name is N-[[5-(2,4-difluorophenyl)-3-pyridinyl]methyl]-2-(1H-indol-7-yloxy)ethanamine.
| Compound Name | N-[[5-(2,4-difluorophenyl)-3-pyridinyl]methyl]-2-(1H-indol-7-yloxy)ethanamine |
|---|---|
| PubChem CID | 10158808 |
| Molecular Formula | C22H19F2N3O |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-[[5-(2,4-difluorophenyl)-3-pyridinyl]methyl]-2-(1H-indol-7-yloxy)ethanamine |
| SMILES | Fc1ccc(-c2cncc(CNCCOc3cccc4cc[nH]c34)c2)c(F)c1 |
| InChI | InChI=1S/C22H19F2N3O/c23-18-4-5-19(20(24)11-18)17-10-15(13-26-14-17)12-25-8-9-28-21-3-1-2-16-6-7-27-22(16)21/h1-7,10-11,13-14,25,27H,8-9,12H2 |
| InChIKey | CLOVXOVXLAVMEW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|